About (2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene
(2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene (PubChem CID 155188283) has the molecular formula C11H20OS
and a molecular weight of 200.35 g/mol. Its IUPAC name is (2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene.
Molecular Properties
| Compound Name | (2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene |
| PubChem CID | 155188283 |
| Molecular Formula | C11H20OS |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene |
| SMILES | COC/C=C\C(C)/C=C\CCSC |
| InChI | InChI=1S/C11H20OS/c1-11(8-6-9-12-2)7-4-5-10-13-3/h4,6-8,11H,5,9-10H2,1-3H3/b7-4-,8-6- |
| InChIKey | OOMFHCMBHDZZAB-TXHKFLPISA-N |
| XLogP | 3.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene?
The IUPAC name of (2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene (CID 155188283) is (2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene.
What is the SMILES notation for (2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene?
The canonical SMILES for (2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene is COC/C=C\C(C)/C=C\CCSC.
What is the InChIKey of (2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene?
The InChIKey is OOMFHCMBHDZZAB-TXHKFLPISA-N. The full InChI is InChI=1S/C11H20OS/c1-11(8-6-9-12-2)7-4-5-10-13-3/h4,6-8,11H,5,9-10H2,1-3H3/b7-4-,8-6-.
What are the key properties of (2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene?
(2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene has a molecular weight of 200.35 g/mol, XLogP of 3.13, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z,5Z)-1-methoxy-4-methyl-8-methylsulfanylocta-2,5-diene is sourced from PubChem (CID 155188283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).