C13H20O3 — CID 15518896
(3R,4aS)-3-methoxy-3,5,5-trimethyl-4,4a,6,7-tetrahydroisochromen-8-one (PubChem CID 15518896) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is (3R,4aS)-3-methoxy-3,5,5-trimethyl-4,4a,6,7-tetrahydroisochromen-8-one.
| Compound Name | (3R,4aS)-3-methoxy-3,5,5-trimethyl-4,4a,6,7-tetrahydroisochromen-8-one |
|---|---|
| PubChem CID | 15518896 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | (3R,4aS)-3-methoxy-3,5,5-trimethyl-4,4a,6,7-tetrahydroisochromen-8-one |
| SMILES | CO[C@@]1(C)C[C@@H]2C(=CO1)C(=O)CCC2(C)C |
| InChI | InChI=1S/C13H20O3/c1-12(2)6-5-11(14)9-8-16-13(3,15-4)7-10(9)12/h8,10H,5-7H2,1-4H3/t10-,13-/m1/s1 |
| InChIKey | SYCYTABZPVFGFK-ZWNOBZJWSA-N |
| XLogP | 2.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |