C18H30N4O2 — CID 155189225
(4S)-4-amino-5-[[4-(5-amino-5-oxopentyl)phenyl]methyl-methylamino]pentanamide (PubChem CID 155189225) has the molecular formula C18H30N4O2 and a molecular weight of 334.46 g/mol. Its IUPAC name is (4S)-4-amino-5-[[4-(5-amino-5-oxopentyl)phenyl]methyl-methylamino]pentanamide.
| Compound Name | (4S)-4-amino-5-[[4-(5-amino-5-oxopentyl)phenyl]methyl-methylamino]pentanamide |
|---|---|
| PubChem CID | 155189225 |
| Molecular Formula | C18H30N4O2 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | (4S)-4-amino-5-[[4-(5-amino-5-oxopentyl)phenyl]methyl-methylamino]pentanamide |
| SMILES | CN(Cc1ccc(CCCCC(N)=O)cc1)C[C@@H](N)CCC(N)=O |
| InChI | InChI=1S/C18H30N4O2/c1-22(13-16(19)10-11-18(21)24)12-15-8-6-14(7-9-15)4-2-3-5-17(20)23/h6-9,16H,2-5,10-13,19H2,1H3,(H2,20,23)(H2,21,24)/t16-/m0/s1 |
| InChIKey | YJFBDNUCMYPJIU-INIZCTEOSA-N |
| XLogP | 0.91 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|