C20H33N3O3 — CID 155189296
(4S,5R)-4-amino-5-[[3-methyl-4-[5-(methylamino)-5-oxopentyl]phenyl]methoxy]hexanamide (PubChem CID 155189296) has the molecular formula C20H33N3O3 and a molecular weight of 363.50 g/mol. Its IUPAC name is (4S,5R)-4-amino-5-[[3-methyl-4-[5-(methylamino)-5-oxopentyl]phenyl]methoxy]hexanamide.
| Compound Name | (4S,5R)-4-amino-5-[[3-methyl-4-[5-(methylamino)-5-oxopentyl]phenyl]methoxy]hexanamide |
|---|---|
| PubChem CID | 155189296 |
| Molecular Formula | C20H33N3O3 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | (4S,5R)-4-amino-5-[[3-methyl-4-[5-(methylamino)-5-oxopentyl]phenyl]methoxy]hexanamide |
| SMILES | CNC(=O)CCCCc1ccc(CO[C@H](C)[C@@H](N)CCC(N)=O)cc1C |
| InChI | InChI=1S/C20H33N3O3/c1-14-12-16(13-26-15(2)18(21)10-11-19(22)24)8-9-17(14)6-4-5-7-20(25)23-3/h8-9,12,15,18H,4-7,10-11,13,21H2,1-3H3,(H2,22,24)(H,23,25)/t15-,18+/m1/s1 |
| InChIKey | QRKDJFHWAYTCBA-QAPCUYQASA-N |
| XLogP | 1.95 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|