About 2,3-dichloro-4-ethyl-1,5-difluorobenzene
2,3-dichloro-4-ethyl-1,5-difluorobenzene (PubChem CID 155190047) has the molecular formula C8H6Cl2F2
and a molecular weight of 211.04 g/mol. Its IUPAC name is 2,3-dichloro-4-ethyl-1,5-difluorobenzene.
Molecular Properties
| Compound Name | 2,3-dichloro-4-ethyl-1,5-difluorobenzene |
| PubChem CID | 155190047 |
| Molecular Formula | C8H6Cl2F2 |
| Molecular Weight | 211.04 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | 2,3-dichloro-4-ethyl-1,5-difluorobenzene |
| SMILES | CCc1c(F)cc(F)c(Cl)c1Cl |
| InChI | InChI=1S/C8H6Cl2F2/c1-2-4-5(11)3-6(12)8(10)7(4)9/h3H,2H2,1H3 |
| InChIKey | OLVYLTNSESUBJE-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.04 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dichloro-4-ethyl-1,5-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dichloro-4-ethyl-1,5-difluorobenzene?
The IUPAC name of 2,3-dichloro-4-ethyl-1,5-difluorobenzene (CID 155190047) is 2,3-dichloro-4-ethyl-1,5-difluorobenzene.
What is the SMILES notation for 2,3-dichloro-4-ethyl-1,5-difluorobenzene?
The canonical SMILES for 2,3-dichloro-4-ethyl-1,5-difluorobenzene is CCc1c(F)cc(F)c(Cl)c1Cl.
What is the InChIKey of 2,3-dichloro-4-ethyl-1,5-difluorobenzene?
The InChIKey is OLVYLTNSESUBJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2F2/c1-2-4-5(11)3-6(12)8(10)7(4)9/h3H,2H2,1H3.
What are the key properties of 2,3-dichloro-4-ethyl-1,5-difluorobenzene?
2,3-dichloro-4-ethyl-1,5-difluorobenzene has a molecular weight of 211.04 g/mol, XLogP of 3.83, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dichloro-4-ethyl-1,5-difluorobenzene is sourced from PubChem (CID 155190047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).