C16H9F5NO6P — CID 155190106
[hydroxy-[2-(2,3,4,5,6-pentafluorophenoxy)carbonyl-1H-indol-5-yl]methyl]phosphonic acid (PubChem CID 155190106) has the molecular formula C16H9F5NO6P and a molecular weight of 437.21 g/mol. Its IUPAC name is [hydroxy-[2-(2,3,4,5,6-pentafluorophenoxy)carbonyl-1H-indol-5-yl]methyl]phosphonic acid.
| Compound Name | [hydroxy-[2-(2,3,4,5,6-pentafluorophenoxy)carbonyl-1H-indol-5-yl]methyl]phosphonic acid |
|---|---|
| PubChem CID | 155190106 |
| Molecular Formula | C16H9F5NO6P |
| Molecular Weight | 437.21 g/mol |
| Exact Mass | 437.01 |
| IUPAC Name | [hydroxy-[2-(2,3,4,5,6-pentafluorophenoxy)carbonyl-1H-indol-5-yl]methyl]phosphonic acid |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1cc2cc(C(O)P(=O)(O)O)ccc2[nH]1 |
| InChI | InChI=1S/C16H9F5NO6P/c17-9-10(18)12(20)14(13(21)11(9)19)28-15(23)8-4-6-3-5(1-2-7(6)22-8)16(24)29(25,26)27/h1-4,16,22,24H,(H2,25,26,27) |
| InChIKey | NAZTUIMTJCVGOQ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.21 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|