About (3S)-6-fluoro-N,1-dimethylazepan-3-amine
(3S)-6-fluoro-N,1-dimethylazepan-3-amine (PubChem CID 155190212) has the molecular formula C8H17FN2
and a molecular weight of 160.24 g/mol. Its IUPAC name is (3S)-6-fluoro-N,1-dimethylazepan-3-amine.
Molecular Properties
| Compound Name | (3S)-6-fluoro-N,1-dimethylazepan-3-amine |
| PubChem CID | 155190212 |
| Molecular Formula | C8H17FN2 |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.14 |
| IUPAC Name | (3S)-6-fluoro-N,1-dimethylazepan-3-amine |
| SMILES | CN[C@H]1CCC(F)CN(C)C1 |
| InChI | InChI=1S/C8H17FN2/c1-10-8-4-3-7(9)5-11(2)6-8/h7-8,10H,3-6H2,1-2H3/t7?,8-/m0/s1 |
| InChIKey | OYQWKYBNHSOCMF-MQWKRIRWSA-N |
| XLogP | 0.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-6-fluoro-N,1-dimethylazepan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-6-fluoro-N,1-dimethylazepan-3-amine?
The IUPAC name of (3S)-6-fluoro-N,1-dimethylazepan-3-amine (CID 155190212) is (3S)-6-fluoro-N,1-dimethylazepan-3-amine.
What is the SMILES notation for (3S)-6-fluoro-N,1-dimethylazepan-3-amine?
The canonical SMILES for (3S)-6-fluoro-N,1-dimethylazepan-3-amine is CN[C@H]1CCC(F)CN(C)C1.
What is the InChIKey of (3S)-6-fluoro-N,1-dimethylazepan-3-amine?
The InChIKey is OYQWKYBNHSOCMF-MQWKRIRWSA-N. The full InChI is InChI=1S/C8H17FN2/c1-10-8-4-3-7(9)5-11(2)6-8/h7-8,10H,3-6H2,1-2H3/t7?,8-/m0/s1.
What are the key properties of (3S)-6-fluoro-N,1-dimethylazepan-3-amine?
(3S)-6-fluoro-N,1-dimethylazepan-3-amine has a molecular weight of 160.24 g/mol, XLogP of 0.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-6-fluoro-N,1-dimethylazepan-3-amine is sourced from PubChem (CID 155190212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).