C21H33NOS — CID 15519063
2,2,6,6-tetramethyl-1-(1-phenylsulfanylhex-5-enoxy)piperidine (PubChem CID 15519063) has the molecular formula C21H33NOS and a molecular weight of 347.57 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1-(1-phenylsulfanylhex-5-enoxy)piperidine.
| Compound Name | 2,2,6,6-tetramethyl-1-(1-phenylsulfanylhex-5-enoxy)piperidine |
|---|---|
| PubChem CID | 15519063 |
| Molecular Formula | C21H33NOS |
| Molecular Weight | 347.57 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | 2,2,6,6-tetramethyl-1-(1-phenylsulfanylhex-5-enoxy)piperidine |
| SMILES | C=CCCCC(ON1C(C)(C)CCCC1(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C21H33NOS/c1-6-7-9-15-19(24-18-13-10-8-11-14-18)23-22-20(2,3)16-12-17-21(22,4)5/h6,8,10-11,13-14,19H,1,7,9,12,15-17H2,2-5H3 |
| InChIKey | LNMHZWLZFXPKQL-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.57 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|