About 4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol
4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol (PubChem CID 155190878) has the molecular formula C12H17NOS
and a molecular weight of 223.34 g/mol. Its IUPAC name is 4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol.
Molecular Properties
| Compound Name | 4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol |
| PubChem CID | 155190878 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol |
| SMILES | CC1C=CC(O)(CCc2ccns2)CC1 |
| InChI | InChI=1S/C12H17NOS/c1-10-2-6-12(14,7-3-10)8-4-11-5-9-13-15-11/h2,5-6,9-10,14H,3-4,7-8H2,1H3 |
| InChIKey | FSFXENYHAQEECN-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol?
The IUPAC name of 4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol (CID 155190878) is 4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol.
What is the SMILES notation for 4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol?
The canonical SMILES for 4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol is CC1C=CC(O)(CCc2ccns2)CC1.
What is the InChIKey of 4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol?
The InChIKey is FSFXENYHAQEECN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NOS/c1-10-2-6-12(14,7-3-10)8-4-11-5-9-13-15-11/h2,5-6,9-10,14H,3-4,7-8H2,1H3.
What are the key properties of 4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol?
4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol has a molecular weight of 223.34 g/mol, XLogP of 2.79, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1-[2-(1,2-thiazol-5-yl)ethyl]cyclohex-2-en-1-ol is sourced from PubChem (CID 155190878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).