C23H25N7OS — CID 155191036
1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-propan-2-yl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one (PubChem CID 155191036) has the molecular formula C23H25N7OS and a molecular weight of 447.57 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-propan-2-yl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one.
| Compound Name | 1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-propan-2-yl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
|---|---|
| PubChem CID | 155191036 |
| Molecular Formula | C23H25N7OS |
| Molecular Weight | 447.57 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 1-(2-cyclopropyl-1,3-thiazol-4-yl)-2-propan-2-yl-6-(1,2,3,4-tetrahydroisoquinolin-6-ylamino)pyrazolo[3,4-d]pyrimidin-3-one |
| SMILES | CC(C)n1c(=O)c2cnc(Nc3ccc4c(c3)CCNC4)nc2n1-c1csc(C2CC2)n1 |
| InChI | InChI=1S/C23H25N7OS/c1-13(2)29-22(31)18-11-25-23(26-17-6-5-16-10-24-8-7-15(16)9-17)28-20(18)30(29)19-12-32-21(27-19)14-3-4-14/h5-6,9,11-14,24H,3-4,7-8,10H2,1-2H3,(H,25,26,28) |
| InChIKey | SLISOYBFTLKCBT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 89.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.57 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |