About N-(6-bromo-1,2,4-triazin-3-yl)acetamide
N-(6-bromo-1,2,4-triazin-3-yl)acetamide (PubChem CID 155191627) has the molecular formula C5H5BrN4O
and a molecular weight of 217.03 g/mol. Its IUPAC name is N-(6-bromo-1,2,4-triazin-3-yl)acetamide.
Molecular Properties
| Compound Name | N-(6-bromo-1,2,4-triazin-3-yl)acetamide |
| PubChem CID | 155191627 |
| Molecular Formula | C5H5BrN4O |
| Molecular Weight | 217.03 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | N-(6-bromo-1,2,4-triazin-3-yl)acetamide |
| SMILES | CC(=O)Nc1ncc(Br)nn1 |
| InChI | InChI=1S/C5H5BrN4O/c1-3(11)8-5-7-2-4(6)9-10-5/h2H,1H3,(H,7,8,10,11) |
| InChIKey | BUNZYLDBGGFHIO-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.03 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(6-bromo-1,2,4-triazin-3-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(6-bromo-1,2,4-triazin-3-yl)acetamide?
The IUPAC name of N-(6-bromo-1,2,4-triazin-3-yl)acetamide (CID 155191627) is N-(6-bromo-1,2,4-triazin-3-yl)acetamide.
What is the SMILES notation for N-(6-bromo-1,2,4-triazin-3-yl)acetamide?
The canonical SMILES for N-(6-bromo-1,2,4-triazin-3-yl)acetamide is CC(=O)Nc1ncc(Br)nn1.
What is the InChIKey of N-(6-bromo-1,2,4-triazin-3-yl)acetamide?
The InChIKey is BUNZYLDBGGFHIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5BrN4O/c1-3(11)8-5-7-2-4(6)9-10-5/h2H,1H3,(H,7,8,10,11).
What are the key properties of N-(6-bromo-1,2,4-triazin-3-yl)acetamide?
N-(6-bromo-1,2,4-triazin-3-yl)acetamide has a molecular weight of 217.03 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(6-bromo-1,2,4-triazin-3-yl)acetamide is sourced from PubChem (CID 155191627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).