C12H12N2O3 — CID 155191752
1-(oxetan-2-ylmethyl)indazole-5-carboxylic acid (PubChem CID 155191752) has the molecular formula C12H12N2O3 and a molecular weight of 232.24 g/mol. Its IUPAC name is 1-(oxetan-2-ylmethyl)indazole-5-carboxylic acid.
| Compound Name | 1-(oxetan-2-ylmethyl)indazole-5-carboxylic acid |
|---|---|
| PubChem CID | 155191752 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 1-(oxetan-2-ylmethyl)indazole-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(cnn2CC2CCO2)c1 |
| InChI | InChI=1S/C12H12N2O3/c15-12(16)8-1-2-11-9(5-8)6-13-14(11)7-10-3-4-17-10/h1-2,5-6,10H,3-4,7H2,(H,15,16) |
| InChIKey | XDRYEHQRBRVERF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |