C26H29N7 — CID 155192092
5-[(4R,9aR)-4-methyl-8-(5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile (PubChem CID 155192092) has the molecular formula C26H29N7 and a molecular weight of 439.57 g/mol. Its IUPAC name is 5-[(4R,9aR)-4-methyl-8-(5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile.
| Compound Name | 5-[(4R,9aR)-4-methyl-8-(5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 155192092 |
| Molecular Formula | C26H29N7 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | 5-[(4R,9aR)-4-methyl-8-(5,6,7,8-tetrahydro-2,7-naphthyridin-4-yl)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[1,2-a]pyrazin-2-yl]quinoline-8-carbonitrile |
| SMILES | C[C@@H]1CN(c2ccc(C#N)c3ncccc23)C[C@@H]2CN(c3cncc4c3CCNC4)CCN21 |
| InChI | InChI=1S/C26H29N7/c1-18-15-32(24-5-4-19(11-27)26-23(24)3-2-7-30-26)17-21-16-31(9-10-33(18)21)25-14-29-13-20-12-28-8-6-22(20)25/h2-5,7,13-14,18,21,28H,6,8-10,12,15-17H2,1H3/t18-,21+/m1/s1 |
| InChIKey | RPHHNWILYSFFFK-NQIIRXRSSA-N |
| XLogP | 2.55 |
| TPSA | 71.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |