C24H24F5N5O3 — CID 155192274
[2,6-difluoro-4-[3-(1,1,1-trifluoropropan-2-yloxy)azetidin-1-yl]phenyl]-[4-(5-methyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperazin-1-yl]methanone (PubChem CID 155192274) has the molecular formula C24H24F5N5O3 and a molecular weight of 525.48 g/mol. Its IUPAC name is [2,6-difluoro-4-[3-(1,1,1-trifluoropropan-2-yloxy)azetidin-1-yl]phenyl]-[4-(5-methyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperazin-1-yl]methanone.
| Compound Name | [2,6-difluoro-4-[3-(1,1,1-trifluoropropan-2-yloxy)azetidin-1-yl]phenyl]-[4-(5-methyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 155192274 |
| Molecular Formula | C24H24F5N5O3 |
| Molecular Weight | 525.48 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | [2,6-difluoro-4-[3-(1,1,1-trifluoropropan-2-yloxy)azetidin-1-yl]phenyl]-[4-(5-methyl-[1,3]oxazolo[4,5-b]pyridin-2-yl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc2oc(N3CCN(C(=O)c4c(F)cc(N5CC(OC(C)C(F)(F)F)C5)cc4F)CC3)nc2n1 |
| InChI | InChI=1S/C24H24F5N5O3/c1-13-3-4-19-21(30-13)31-23(37-19)33-7-5-32(6-8-33)22(35)20-17(25)9-15(10-18(20)26)34-11-16(12-34)36-14(2)24(27,28)29/h3-4,9-10,14,16H,5-8,11-12H2,1-2H3 |
| InChIKey | AKCODYVEPRICSM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.48 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |