About (2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane
(2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane (PubChem CID 155192452) has the molecular formula C17H19F5OS
and a molecular weight of 366.40 g/mol. Its IUPAC name is (2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane.
Molecular Properties
| Compound Name | (2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane |
| PubChem CID | 155192452 |
| Molecular Formula | C17H19F5OS |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane |
| SMILES | CC(C)OC(CS(F)(F)(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H19F5OS/c1-14(2)23-17(13-24(18,19,20,21)22,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14H,13H2,1-2H3 |
| InChIKey | NNZNACNLTGQQRE-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane?
The IUPAC name of (2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane (CID 155192452) is (2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane.
What is the SMILES notation for (2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane?
The canonical SMILES for (2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane is CC(C)OC(CS(F)(F)(F)(F)F)(c1ccccc1)c1ccccc1.
What is the InChIKey of (2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane?
The InChIKey is NNZNACNLTGQQRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19F5OS/c1-14(2)23-17(13-24(18,19,20,21)22,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14H,13H2,1-2H3.
What are the key properties of (2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane?
(2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane has a molecular weight of 366.40 g/mol, XLogP of 6.65, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2-diphenyl-2-propan-2-yloxyethyl)-pentafluoro-λ6-sulfane is sourced from PubChem (CID 155192452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).