About [(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane
[(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane (PubChem CID 155192454) has the molecular formula C17H15F5OS
and a molecular weight of 362.36 g/mol. Its IUPAC name is [(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane.
Molecular Properties
| Compound Name | [(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane |
| PubChem CID | 155192454 |
| Molecular Formula | C17H15F5OS |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | [(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane |
| SMILES | FS(F)(F)(F)(F)/C=C1\COC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C17H15F5OS/c18-24(19,20,21,22)13-14-11-17(23-12-14,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,13H,11-12H2/b14-13- |
| InChIKey | YOZRWIUAHQGLIL-YPKPFQOOSA-N |
| XLogP | 6.53 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane?
The IUPAC name of [(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane (CID 155192454) is [(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane.
What is the SMILES notation for [(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane?
The canonical SMILES for [(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane is FS(F)(F)(F)(F)/C=C1\COC(c2ccccc2)(c2ccccc2)C1.
What is the InChIKey of [(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane?
The InChIKey is YOZRWIUAHQGLIL-YPKPFQOOSA-N. The full InChI is InChI=1S/C17H15F5OS/c18-24(19,20,21,22)13-14-11-17(23-12-14,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,13H,11-12H2/b14-13-.
What are the key properties of [(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane?
[(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane has a molecular weight of 362.36 g/mol, XLogP of 6.53, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(5,5-diphenyloxolan-3-ylidene)methyl]-pentafluoro-λ6-sulfane is sourced from PubChem (CID 155192454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).