C9H10F6Te — CID 15519415
3,4-dimethyl-6,6-bis(trifluoromethyl)-2,5-dihydrotelluropyran (PubChem CID 15519415) has the molecular formula C9H10F6Te and a molecular weight of 359.77 g/mol. Its IUPAC name is 3,4-dimethyl-6,6-bis(trifluoromethyl)-2,5-dihydrotelluropyran.
| Compound Name | 3,4-dimethyl-6,6-bis(trifluoromethyl)-2,5-dihydrotelluropyran |
|---|---|
| PubChem CID | 15519415 |
| Molecular Formula | C9H10F6Te |
| Molecular Weight | 359.77 g/mol |
| Exact Mass | 361.97 |
| IUPAC Name | 3,4-dimethyl-6,6-bis(trifluoromethyl)-2,5-dihydrotelluropyran |
| SMILES | CC1=C(C)CC(C(F)(F)F)(C(F)(F)F)[Te]C1 |
| InChI | InChI=1S/C9H10F6Te/c1-5-3-7(8(10,11)12,9(13,14)15)16-4-6(5)2/h3-4H2,1-2H3 |
| InChIKey | NGYRDLBTZDSLBR-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.77 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|