C10H16O5 — CID 15519522
(3aS,4S,6S,6aS)-4-ethoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbaldehyde (PubChem CID 15519522) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is (3aS,4S,6S,6aS)-4-ethoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbaldehyde.
| Compound Name | (3aS,4S,6S,6aS)-4-ethoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbaldehyde |
|---|---|
| PubChem CID | 15519522 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (3aS,4S,6S,6aS)-4-ethoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxole-6-carbaldehyde |
| SMILES | CCO[C@H]1O[C@H](C=O)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C10H16O5/c1-4-12-9-8-7(6(5-11)13-9)14-10(2,3)15-8/h5-9H,4H2,1-3H3/t6-,7+,8+,9+/m1/s1 |
| InChIKey | DEUUQPSPUWPFJO-XGEHTFHBSA-N |
| XLogP | 0.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|