C25H23F2N5O3 — CID 155195341
3-[6-[[1-(3,3-difluoropiperidin-4-yl)pyrazol-4-yl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione (PubChem CID 155195341) has the molecular formula C25H23F2N5O3 and a molecular weight of 479.49 g/mol. Its IUPAC name is 3-[6-[[1-(3,3-difluoropiperidin-4-yl)pyrazol-4-yl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[[1-(3,3-difluoropiperidin-4-yl)pyrazol-4-yl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 155195341 |
| Molecular Formula | C25H23F2N5O3 |
| Molecular Weight | 479.49 g/mol |
| Exact Mass | 479.18 |
| IUPAC Name | 3-[6-[[1-(3,3-difluoropiperidin-4-yl)pyrazol-4-yl]methyl]-2-oxobenzo[cd]indol-1-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc4c(Cc5cnn(C6CCNCC6(F)F)c5)ccc2c34)C(=O)N1 |
| InChI | InChI=1S/C25H23F2N5O3/c26-25(27)13-28-9-8-20(25)31-12-14(11-29-31)10-15-4-5-18-22-16(15)2-1-3-17(22)24(35)32(18)19-6-7-21(33)30-23(19)34/h1-5,11-12,19-20,28H,6-10,13H2,(H,30,33,34) |
| InChIKey | KCKAHYXRNFPZMK-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 96.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.49 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|