About 3-amino-6-hydroxy-2,3-dihydrochromen-4-one
3-amino-6-hydroxy-2,3-dihydrochromen-4-one (PubChem CID 155195436) has the molecular formula C9H9NO3
and a molecular weight of 179.18 g/mol. Its IUPAC name is 3-amino-6-hydroxy-2,3-dihydrochromen-4-one.
Molecular Properties
| Compound Name | 3-amino-6-hydroxy-2,3-dihydrochromen-4-one |
| PubChem CID | 155195436 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 3-amino-6-hydroxy-2,3-dihydrochromen-4-one |
| SMILES | NC1COc2ccc(O)cc2C1=O |
| InChI | InChI=1S/C9H9NO3/c10-7-4-13-8-2-1-5(11)3-6(8)9(7)12/h1-3,7,11H,4,10H2 |
| InChIKey | JQXPJCIFQURRCH-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-6-hydroxy-2,3-dihydrochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-hydroxy-2,3-dihydrochromen-4-one?
The IUPAC name of 3-amino-6-hydroxy-2,3-dihydrochromen-4-one (CID 155195436) is 3-amino-6-hydroxy-2,3-dihydrochromen-4-one.
What is the SMILES notation for 3-amino-6-hydroxy-2,3-dihydrochromen-4-one?
The canonical SMILES for 3-amino-6-hydroxy-2,3-dihydrochromen-4-one is NC1COc2ccc(O)cc2C1=O.
What is the InChIKey of 3-amino-6-hydroxy-2,3-dihydrochromen-4-one?
The InChIKey is JQXPJCIFQURRCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c10-7-4-13-8-2-1-5(11)3-6(8)9(7)12/h1-3,7,11H,4,10H2.
What are the key properties of 3-amino-6-hydroxy-2,3-dihydrochromen-4-one?
3-amino-6-hydroxy-2,3-dihydrochromen-4-one has a molecular weight of 179.18 g/mol, XLogP of 0.29, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-hydroxy-2,3-dihydrochromen-4-one is sourced from PubChem (CID 155195436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).