C23H29N5O2 — CID 155195496
N-[4-[(2S,5S)-2-(6-amino-3-pyridinyl)-5-methylmorpholin-4-yl]butyl]-1H-indole-2-carboxamide (PubChem CID 155195496) has the molecular formula C23H29N5O2 and a molecular weight of 407.52 g/mol. Its IUPAC name is N-[4-[(2S,5S)-2-(6-amino-3-pyridinyl)-5-methylmorpholin-4-yl]butyl]-1H-indole-2-carboxamide.
| Compound Name | N-[4-[(2S,5S)-2-(6-amino-3-pyridinyl)-5-methylmorpholin-4-yl]butyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 155195496 |
| Molecular Formula | C23H29N5O2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | N-[4-[(2S,5S)-2-(6-amino-3-pyridinyl)-5-methylmorpholin-4-yl]butyl]-1H-indole-2-carboxamide |
| SMILES | C[C@H]1CO[C@@H](c2ccc(N)nc2)CN1CCCCNC(=O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C23H29N5O2/c1-16-15-30-21(18-8-9-22(24)26-13-18)14-28(16)11-5-4-10-25-23(29)20-12-17-6-2-3-7-19(17)27-20/h2-3,6-9,12-13,16,21,27H,4-5,10-11,14-15H2,1H3,(H2,24,26)(H,25,29)/t16-,21+/m0/s1 |
| InChIKey | CTDCQQXDSZWWIE-HRAATJIYSA-N |
| XLogP | 3.12 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|