C40H25BrN6 — CID 155195967
5-[3-[4,6-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]-5-bromophenyl]quinoline (PubChem CID 155195967) has the molecular formula C40H25BrN6 and a molecular weight of 669.59 g/mol. Its IUPAC name is 5-[3-[4,6-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]-5-bromophenyl]quinoline.
| Compound Name | 5-[3-[4,6-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]-5-bromophenyl]quinoline |
|---|---|
| PubChem CID | 155195967 |
| Molecular Formula | C40H25BrN6 |
| Molecular Weight | 669.59 g/mol |
| Exact Mass | 668.13 |
| IUPAC Name | 5-[3-[4,6-bis(4-pyridin-4-ylphenyl)-1,3,5-triazin-2-yl]-5-bromophenyl]quinoline |
| SMILES | Brc1cc(-c2nc(-c3ccc(-c4ccncc4)cc3)nc(-c3ccc(-c4ccncc4)cc3)n2)cc(-c2cccc3ncccc23)c1 |
| InChI | InChI=1S/C40H25BrN6/c41-34-24-32(35-3-1-5-37-36(35)4-2-18-44-37)23-33(25-34)40-46-38(30-10-6-26(7-11-30)28-14-19-42-20-15-28)45-39(47-40)31-12-8-27(9-13-31)29-16-21-43-22-17-29/h1-25H |
| InChIKey | SVZXSJHMTGMTOX-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.59 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |