C15H15ClN4O3 — CID 155196042
(3-chlorophenyl) N'-[(E)-2-(2,4-dioxo-1,3-diazinan-1-yl)prop-1-enyl]-N-methylidenecarbamimidate (PubChem CID 155196042) has the molecular formula C15H15ClN4O3 and a molecular weight of 334.76 g/mol. Its IUPAC name is (3-chlorophenyl) N'-[(E)-2-(2,4-dioxo-1,3-diazinan-1-yl)prop-1-enyl]-N-methylidenecarbamimidate.
| Compound Name | (3-chlorophenyl) N'-[(E)-2-(2,4-dioxo-1,3-diazinan-1-yl)prop-1-enyl]-N-methylidenecarbamimidate |
|---|---|
| PubChem CID | 155196042 |
| Molecular Formula | C15H15ClN4O3 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | (3-chlorophenyl) N'-[(E)-2-(2,4-dioxo-1,3-diazinan-1-yl)prop-1-enyl]-N-methylidenecarbamimidate |
| SMILES | C=N/C(=N\C=C(/C)N1CCC(=O)NC1=O)Oc1cccc(Cl)c1 |
| InChI | InChI=1S/C15H15ClN4O3/c1-10(20-7-6-13(21)19-15(20)22)9-18-14(17-2)23-12-5-3-4-11(16)8-12/h3-5,8-9H,2,6-7H2,1H3,(H,19,21,22)/b10-9+,18-14+ |
| InChIKey | NTESGWQEZWXUTK-BFHPBESDSA-N |
| XLogP | 2.58 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|