C21H31N — CID 155196334
N-[(4E,6E)-7-tert-butyl-3-methylidenenona-1,4,6,8-tetraen-4-yl]-4,4-dimethylpent-1-en-3-imine (PubChem CID 155196334) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is N-[(4E,6E)-7-tert-butyl-3-methylidenenona-1,4,6,8-tetraen-4-yl]-4,4-dimethylpent-1-en-3-imine.
| Compound Name | N-[(4E,6E)-7-tert-butyl-3-methylidenenona-1,4,6,8-tetraen-4-yl]-4,4-dimethylpent-1-en-3-imine |
|---|---|
| PubChem CID | 155196334 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | N-[(4E,6E)-7-tert-butyl-3-methylidenenona-1,4,6,8-tetraen-4-yl]-4,4-dimethylpent-1-en-3-imine |
| SMILES | C=CC(=C)C(=C\C=C(/C=C)C(C)(C)C)/N=C(\C=C)C(C)(C)C |
| InChI | InChI=1S/C21H31N/c1-11-16(4)18(22-19(13-3)21(8,9)10)15-14-17(12-2)20(5,6)7/h11-15H,1-4H2,5-10H3/b17-14+,18-15+,22-19+ |
| InChIKey | KMYWIRYGXBZULD-LNNUQWBSSA-N |
| XLogP | 6.44 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|