C20H18F4N4O3 — CID 155196886
[5-(4-fluorophenyl)-1,2-oxazol-3-yl]-[(5S)-5-methyl-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone (PubChem CID 155196886) has the molecular formula C20H18F4N4O3 and a molecular weight of 438.38 g/mol. Its IUPAC name is [5-(4-fluorophenyl)-1,2-oxazol-3-yl]-[(5S)-5-methyl-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone.
| Compound Name | [5-(4-fluorophenyl)-1,2-oxazol-3-yl]-[(5S)-5-methyl-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone |
|---|---|
| PubChem CID | 155196886 |
| Molecular Formula | C20H18F4N4O3 |
| Molecular Weight | 438.38 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | [5-(4-fluorophenyl)-1,2-oxazol-3-yl]-[(5S)-5-methyl-3-(1,1,1-trifluoro-2-hydroxypropan-2-yl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl]methanone |
| SMILES | C[C@H]1CN(C(=O)c2cc(-c3ccc(F)cc3)on2)Cc2cnc(C(C)(O)C(F)(F)F)n21 |
| InChI | InChI=1S/C20H18F4N4O3/c1-11-9-27(10-14-8-25-18(28(11)14)19(2,30)20(22,23)24)17(29)15-7-16(31-26-15)12-3-5-13(21)6-4-12/h3-8,11,30H,9-10H2,1-2H3/t11-,19?/m0/s1 |
| InChIKey | DWFZVULACSFMRM-IFGYVTRGSA-N |
| XLogP | 3.66 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |