C12H21N — CID 155197259
2,3,4,5,6,6-hexamethylcyclohexa-1,3-dien-1-amine (PubChem CID 155197259) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 2,3,4,5,6,6-hexamethylcyclohexa-1,3-dien-1-amine.
| Compound Name | 2,3,4,5,6,6-hexamethylcyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 155197259 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 2,3,4,5,6,6-hexamethylcyclohexa-1,3-dien-1-amine |
| SMILES | CC1=C(C)C(C)C(C)(C)C(N)=C1C |
| InChI | InChI=1S/C12H21N/c1-7-8(2)10(4)12(5,6)11(13)9(7)3/h10H,13H2,1-6H3 |
| InChIKey | CZRYJWNYWQZFJF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |