C16H22FNS — CID 155197663
(2E,4E)-5-[4-[2-fluoroethyl(methyl)amino]cyclohexa-1,5-dien-1-yl]hepta-2,4,6-triene-2-thiol (PubChem CID 155197663) has the molecular formula C16H22FNS and a molecular weight of 279.42 g/mol. Its IUPAC name is (2E,4E)-5-[4-[2-fluoroethyl(methyl)amino]cyclohexa-1,5-dien-1-yl]hepta-2,4,6-triene-2-thiol.
| Compound Name | (2E,4E)-5-[4-[2-fluoroethyl(methyl)amino]cyclohexa-1,5-dien-1-yl]hepta-2,4,6-triene-2-thiol |
|---|---|
| PubChem CID | 155197663 |
| Molecular Formula | C16H22FNS |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | (2E,4E)-5-[4-[2-fluoroethyl(methyl)amino]cyclohexa-1,5-dien-1-yl]hepta-2,4,6-triene-2-thiol |
| SMILES | C=C/C(=C\C=C(/C)S)C1=CCC(N(C)CCF)C=C1 |
| InChI | InChI=1S/C16H22FNS/c1-4-14(6-5-13(2)19)15-7-9-16(10-8-15)18(3)12-11-17/h4-9,16,19H,1,10-12H2,2-3H3/b13-5+,14-6+ |
| InChIKey | SOHOUYJIEWSMPW-ACFHMISVSA-N |
| XLogP | 4.09 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|