About N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide
N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide (PubChem CID 155197701) has the molecular formula C13H20FNO
and a molecular weight of 225.31 g/mol. Its IUPAC name is N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide |
| PubChem CID | 155197701 |
| Molecular Formula | C13H20FNO |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide |
| SMILES | CC(C)C1C=CC(C(=O)N(C)CCF)=CC1 |
| InChI | InChI=1S/C13H20FNO/c1-10(2)11-4-6-12(7-5-11)13(16)15(3)9-8-14/h4,6-7,10-11H,5,8-9H2,1-3H3 |
| InChIKey | HZEBSYCVMCDFLY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide?
The IUPAC name of N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide (CID 155197701) is N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide.
What is the SMILES notation for N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide?
The canonical SMILES for N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide is CC(C)C1C=CC(C(=O)N(C)CCF)=CC1.
What is the InChIKey of N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide?
The InChIKey is HZEBSYCVMCDFLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20FNO/c1-10(2)11-4-6-12(7-5-11)13(16)15(3)9-8-14/h4,6-7,10-11H,5,8-9H2,1-3H3.
What are the key properties of N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide?
N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide has a molecular weight of 225.31 g/mol, XLogP of 2.57, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-fluoroethyl)-N-methyl-4-propan-2-ylcyclohexa-1,5-diene-1-carboxamide is sourced from PubChem (CID 155197701), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).