About 4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine
4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine (PubChem CID 155197749) has the molecular formula C9H11FN2
and a molecular weight of 166.20 g/mol. Its IUPAC name is 4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine |
| PubChem CID | 155197749 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine |
| SMILES | Cc1cc2c(n1C)=NCCC=2F |
| InChI | InChI=1S/C9H11FN2/c1-6-5-7-8(10)3-4-11-9(7)12(6)2/h5H,3-4H2,1-2H3 |
| InChIKey | BWVWETBWAJUIEU-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze 4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine?
The IUPAC name of 4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine (CID 155197749) is 4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine.
What is the SMILES notation for 4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine?
The canonical SMILES for 4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine is Cc1cc2c(n1C)=NCCC=2F.
What is the InChIKey of 4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine?
The InChIKey is BWVWETBWAJUIEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11FN2/c1-6-5-7-8(10)3-4-11-9(7)12(6)2/h5H,3-4H2,1-2H3.
What are the key properties of 4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine?
4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine has a molecular weight of 166.20 g/mol, XLogP of 0.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,2-dimethyl-5,6-dihydropyrrolo[2,3-b]pyridine is sourced from PubChem (CID 155197749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).