About (2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine
(2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine (PubChem CID 155197758) has the molecular formula C8H12F3NO
and a molecular weight of 195.18 g/mol. Its IUPAC name is (2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine.
Molecular Properties
| Compound Name | (2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine |
| PubChem CID | 155197758 |
| Molecular Formula | C8H12F3NO |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine |
| SMILES | C/C=C(\C=C/COC(F)(F)F)NC |
| InChI | InChI=1S/C8H12F3NO/c1-3-7(12-2)5-4-6-13-8(9,10)11/h3-5,12H,6H2,1-2H3/b5-4-,7-3+ |
| InChIKey | ROFGLCQPKPPIGI-SBYNAHCQSA-N |
| XLogP | 2.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine?
The IUPAC name of (2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine (CID 155197758) is (2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine.
What is the SMILES notation for (2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine?
The canonical SMILES for (2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine is C/C=C(\C=C/COC(F)(F)F)NC.
What is the InChIKey of (2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine?
The InChIKey is ROFGLCQPKPPIGI-SBYNAHCQSA-N. The full InChI is InChI=1S/C8H12F3NO/c1-3-7(12-2)5-4-6-13-8(9,10)11/h3-5,12H,6H2,1-2H3/b5-4-,7-3+.
What are the key properties of (2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine?
(2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine has a molecular weight of 195.18 g/mol, XLogP of 2.20, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-N-methyl-6-(trifluoromethoxy)hexa-2,4-dien-3-amine is sourced from PubChem (CID 155197758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).