C9H17NS — CID 155197761
(2Z,4E)-N,N-dimethyl-2-methylsulfanylhexa-2,4-dien-1-amine (PubChem CID 155197761) has the molecular formula C9H17NS and a molecular weight of 171.31 g/mol. Its IUPAC name is (2Z,4E)-N,N-dimethyl-2-methylsulfanylhexa-2,4-dien-1-amine.
| Compound Name | (2Z,4E)-N,N-dimethyl-2-methylsulfanylhexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 155197761 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | (2Z,4E)-N,N-dimethyl-2-methylsulfanylhexa-2,4-dien-1-amine |
| SMILES | C/C=C/C=C(/CN(C)C)SC |
| InChI | InChI=1S/C9H17NS/c1-5-6-7-9(11-4)8-10(2)3/h5-7H,8H2,1-4H3/b6-5+,9-7- |
| InChIKey | CYEFCIUTIIGNMT-UQIVLYAPSA-N |
| XLogP | 2.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|