C9H14FN — CID 155197849
(2Z,4Z)-3-fluoro-N,N-dimethylhepta-2,4,6-trien-2-amine (PubChem CID 155197849) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is (2Z,4Z)-3-fluoro-N,N-dimethylhepta-2,4,6-trien-2-amine.
| Compound Name | (2Z,4Z)-3-fluoro-N,N-dimethylhepta-2,4,6-trien-2-amine |
|---|---|
| PubChem CID | 155197849 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (2Z,4Z)-3-fluoro-N,N-dimethylhepta-2,4,6-trien-2-amine |
| SMILES | C=C/C=C\C(F)=C(/C)N(C)C |
| InChI | InChI=1S/C9H14FN/c1-5-6-7-9(10)8(2)11(3)4/h5-7H,1H2,2-4H3/b7-6-,9-8- |
| InChIKey | GKMXSVPXSONGQT-JPDBVBESSA-N |
| XLogP | 2.49 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|