C17H16FN3 — CID 155197865
4-[2-(4-fluoro-1H-1,3-diazonin-9-yl)ethynyl]-N,N-dimethylaniline (PubChem CID 155197865) has the molecular formula C17H16FN3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-[2-(4-fluoro-1H-1,3-diazonin-9-yl)ethynyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-(4-fluoro-1H-1,3-diazonin-9-yl)ethynyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 155197865 |
| Molecular Formula | C17H16FN3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-[2-(4-fluoro-1H-1,3-diazonin-9-yl)ethynyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C#Cc2ccccc(F)nc[nH]2)cc1 |
| InChI | InChI=1S/C17H16FN3/c1-21(2)16-11-8-14(9-12-16)7-10-15-5-3-4-6-17(18)20-13-19-15/h3-6,8-9,11-13H,1-2H3,(H,19,20)/b4-3-,15-5-,17-6- |
| InChIKey | XEJKUOUAJAVNSR-RJESCBBCSA-N |
| XLogP | 3.14 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|