C24H20FN3O — CID 155197872
4-[4-[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-2-yl)ethynyl]phenoxy]-N,N,3-trimethylaniline (PubChem CID 155197872) has the molecular formula C24H20FN3O and a molecular weight of 385.44 g/mol. Its IUPAC name is 4-[4-[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-2-yl)ethynyl]phenoxy]-N,N,3-trimethylaniline.
| Compound Name | 4-[4-[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-2-yl)ethynyl]phenoxy]-N,N,3-trimethylaniline |
|---|---|
| PubChem CID | 155197872 |
| Molecular Formula | C24H20FN3O |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 4-[4-[2-(5-fluoro-1H-pyrrolo[2,3-b]pyridin-2-yl)ethynyl]phenoxy]-N,N,3-trimethylaniline |
| SMILES | Cc1cc(N(C)C)ccc1Oc1ccc(C#Cc2cc3cc(F)cnc3[nH]2)cc1 |
| InChI | InChI=1S/C24H20FN3O/c1-16-12-21(28(2)3)8-11-23(16)29-22-9-5-17(6-10-22)4-7-20-14-18-13-19(25)15-26-24(18)27-20/h5-6,8-15H,1-3H3,(H,26,27) |
| InChIKey | VZATWOOFJFKESI-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|