C12H20FN — CID 155197917
(2E,3Z)-2-ethylidene-N-(2-fluoroethyl)-N,5-dimethylhexa-3,5-dien-1-amine (PubChem CID 155197917) has the molecular formula C12H20FN and a molecular weight of 197.30 g/mol. Its IUPAC name is (2E,3Z)-2-ethylidene-N-(2-fluoroethyl)-N,5-dimethylhexa-3,5-dien-1-amine.
| Compound Name | (2E,3Z)-2-ethylidene-N-(2-fluoroethyl)-N,5-dimethylhexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 155197917 |
| Molecular Formula | C12H20FN |
| Molecular Weight | 197.30 g/mol |
| Exact Mass | 197.16 |
| IUPAC Name | (2E,3Z)-2-ethylidene-N-(2-fluoroethyl)-N,5-dimethylhexa-3,5-dien-1-amine |
| SMILES | C=C(C)/C=C\C(=C/C)CN(C)CCF |
| InChI | InChI=1S/C12H20FN/c1-5-12(7-6-11(2)3)10-14(4)9-8-13/h5-7H,2,8-10H2,1,3-4H3/b7-6-,12-5+ |
| InChIKey | AHAGWFQDSWOPSD-BZNMCICSSA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.30 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|