C15H13FN2 — CID 155197927
2-[2-(6-fluorocyclohexa-1,5-dien-1-yl)ethynyl]-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 155197927) has the molecular formula C15H13FN2 and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-[2-(6-fluorocyclohexa-1,5-dien-1-yl)ethynyl]-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine.
| Compound Name | 2-[2-(6-fluorocyclohexa-1,5-dien-1-yl)ethynyl]-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 155197927 |
| Molecular Formula | C15H13FN2 |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 2-[2-(6-fluorocyclohexa-1,5-dien-1-yl)ethynyl]-5,6-dihydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | FC1=CCCC=C1C#Cc1cc2c([nH]1)=NCCC=2 |
| InChI | InChI=1S/C15H13FN2/c16-14-6-2-1-4-11(14)7-8-13-10-12-5-3-9-17-15(12)18-13/h4-6,10H,1-3,9H2,(H,17,18) |
| InChIKey | AIVYIZVEDRPTCY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|