C64H48N2 — CID 155198001
(7E)-2-[3-[5-(9,9-dimethylfluoren-3-yl)triphenylen-2-yl]phenyl]-7-methyl-8-phenyl-4-(4-phenylphenyl)-5,6-dihydro-1,3-diazocine (PubChem CID 155198001) has the molecular formula C64H48N2 and a molecular weight of 845.10 g/mol. Its IUPAC name is (7E)-2-[3-[5-(9,9-dimethylfluoren-3-yl)triphenylen-2-yl]phenyl]-7-methyl-8-phenyl-4-(4-phenylphenyl)-5,6-dihydro-1,3-diazocine.
| Compound Name | (7E)-2-[3-[5-(9,9-dimethylfluoren-3-yl)triphenylen-2-yl]phenyl]-7-methyl-8-phenyl-4-(4-phenylphenyl)-5,6-dihydro-1,3-diazocine |
|---|---|
| PubChem CID | 155198001 |
| Molecular Formula | C64H48N2 |
| Molecular Weight | 845.10 g/mol |
| Exact Mass | 844.38 |
| IUPAC Name | (7E)-2-[3-[5-(9,9-dimethylfluoren-3-yl)triphenylen-2-yl]phenyl]-7-methyl-8-phenyl-4-(4-phenylphenyl)-5,6-dihydro-1,3-diazocine |
| SMILES | C/C1=C(c2ccccc2)/N=C(c2cccc(-c3ccc4c(c3)c3ccccc3c3cccc(-c5ccc6c(c5)-c5ccccc5C6(C)C)c34)c2)\N=C(\c2ccc(-c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C64H48N2/c1-41-28-37-60(44-31-29-43(30-32-44)42-16-6-4-7-17-42)65-63(66-62(41)45-18-8-5-9-19-45)49-21-14-20-46(38-49)47-33-35-55-56(39-47)52-23-11-10-22-51(52)54-26-15-25-50(61(54)55)48-34-36-59-57(40-48)53-24-12-13-27-58(53)64(59,2)3/h4-27,29-36,38-40H,28,37H2,1-3H3/b62-41-,65-60+,66-63- |
| InChIKey | YAXVYLNAEGCSFG-NQOGRQFGSA-N |
| XLogP | 16.91 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.10 |
| LogP ≤ 5 | 16.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|