About N-ethyl-5,6-dimethylhept-6-en-1-amine
N-ethyl-5,6-dimethylhept-6-en-1-amine (PubChem CID 155198901) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is N-ethyl-5,6-dimethylhept-6-en-1-amine.
Molecular Properties
| Compound Name | N-ethyl-5,6-dimethylhept-6-en-1-amine |
| PubChem CID | 155198901 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | N-ethyl-5,6-dimethylhept-6-en-1-amine |
| SMILES | C=C(C)C(C)CCCCNCC |
| InChI | InChI=1S/C11H23N/c1-5-12-9-7-6-8-11(4)10(2)3/h11-12H,2,5-9H2,1,3-4H3 |
| InChIKey | UXLBFSXJNRJLRJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-5,6-dimethylhept-6-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-5,6-dimethylhept-6-en-1-amine?
The IUPAC name of N-ethyl-5,6-dimethylhept-6-en-1-amine (CID 155198901) is N-ethyl-5,6-dimethylhept-6-en-1-amine.
What is the SMILES notation for N-ethyl-5,6-dimethylhept-6-en-1-amine?
The canonical SMILES for N-ethyl-5,6-dimethylhept-6-en-1-amine is C=C(C)C(C)CCCCNCC.
What is the InChIKey of N-ethyl-5,6-dimethylhept-6-en-1-amine?
The InChIKey is UXLBFSXJNRJLRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N/c1-5-12-9-7-6-8-11(4)10(2)3/h11-12H,2,5-9H2,1,3-4H3.
What are the key properties of N-ethyl-5,6-dimethylhept-6-en-1-amine?
N-ethyl-5,6-dimethylhept-6-en-1-amine has a molecular weight of 169.31 g/mol, XLogP of 2.98, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-5,6-dimethylhept-6-en-1-amine is sourced from PubChem (CID 155198901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).