About 12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione
12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione (PubChem CID 155198904) has the molecular formula C16H25NO4
and a molecular weight of 295.38 g/mol. Its IUPAC name is 12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione.
Molecular Properties
| Compound Name | 12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione |
| PubChem CID | 155198904 |
| Molecular Formula | C16H25NO4 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | 12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione |
| SMILES | COc1cc(CCCCCCC(=O)CCCC(C)=O)on1 |
| InChI | InChI=1S/C16H25NO4/c1-13(18)8-7-10-14(19)9-5-3-4-6-11-15-12-16(20-2)17-21-15/h12H,3-11H2,1-2H3 |
| InChIKey | AHSBZSANDSAINH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione?
The IUPAC name of 12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione (CID 155198904) is 12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione.
What is the SMILES notation for 12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione?
The canonical SMILES for 12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione is COc1cc(CCCCCCC(=O)CCCC(C)=O)on1.
What is the InChIKey of 12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione?
The InChIKey is AHSBZSANDSAINH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO4/c1-13(18)8-7-10-14(19)9-5-3-4-6-11-15-12-16(20-2)17-21-15/h12H,3-11H2,1-2H3.
What are the key properties of 12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione?
12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione has a molecular weight of 295.38 g/mol, XLogP of 3.50, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 12-(3-methoxy-1,2-oxazol-5-yl)dodecane-2,6-dione is sourced from PubChem (CID 155198904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).