C13H18F3N5 — CID 155198950
4-N-butyl-6-methyl-5-(1,1,1-trifluorobut-3-en-2-ylideneamino)pyrimidine-2,4-diamine (PubChem CID 155198950) has the molecular formula C13H18F3N5 and a molecular weight of 301.32 g/mol. Its IUPAC name is 4-N-butyl-6-methyl-5-(1,1,1-trifluorobut-3-en-2-ylideneamino)pyrimidine-2,4-diamine.
| Compound Name | 4-N-butyl-6-methyl-5-(1,1,1-trifluorobut-3-en-2-ylideneamino)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 155198950 |
| Molecular Formula | C13H18F3N5 |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-N-butyl-6-methyl-5-(1,1,1-trifluorobut-3-en-2-ylideneamino)pyrimidine-2,4-diamine |
| SMILES | C=C/C(=N\c1c(C)nc(N)nc1NCCCC)C(F)(F)F |
| InChI | InChI=1S/C13H18F3N5/c1-4-6-7-18-11-10(8(3)19-12(17)21-11)20-9(5-2)13(14,15)16/h5H,2,4,6-7H2,1,3H3,(H3,17,18,19,21)/b20-9+ |
| InChIKey | RBDGJHNNAOHLBT-AWQFTUOYSA-N |
| XLogP | 3.40 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|