C31H29N3O3 — CID 155199062
2-methyl-N-[1-[(2-methylnaphthalen-1-yl)methyl]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]propanamide (PubChem CID 155199062) has the molecular formula C31H29N3O3 and a molecular weight of 491.59 g/mol. Its IUPAC name is 2-methyl-N-[1-[(2-methylnaphthalen-1-yl)methyl]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]propanamide.
| Compound Name | 2-methyl-N-[1-[(2-methylnaphthalen-1-yl)methyl]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]propanamide |
|---|---|
| PubChem CID | 155199062 |
| Molecular Formula | C31H29N3O3 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.22 |
| IUPAC Name | 2-methyl-N-[1-[(2-methylnaphthalen-1-yl)methyl]-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]propanamide |
| SMILES | Cc1ccc2ccccc2c1CN1C(=O)C(NC(=O)C(C)C)C(=O)N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C31H29N3O3/c1-20(2)29(35)32-28-30(36)33(19-25-21(3)17-18-22-11-7-8-14-24(22)25)26-15-9-10-16-27(26)34(31(28)37)23-12-5-4-6-13-23/h4-18,20,28H,19H2,1-3H3,(H,32,35) |
| InChIKey | QKNMVVDUJSVTGK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|