C33H55N3O — CID 155199968
3-[(8S)-4-(cyclobutylmethyl)-8-hexan-2-yl-3-methyl-2-oxo-8-phenyl-azacycloundec-1-yl]-2,2-dimethylpropanimidamide (PubChem CID 155199968) has the molecular formula C33H55N3O and a molecular weight of 509.82 g/mol. Its IUPAC name is 3-[(8S)-4-(cyclobutylmethyl)-8-hexan-2-yl-3-methyl-2-oxo-8-phenyl-azacycloundec-1-yl]-2,2-dimethylpropanimidamide.
| Compound Name | 3-[(8S)-4-(cyclobutylmethyl)-8-hexan-2-yl-3-methyl-2-oxo-8-phenyl-azacycloundec-1-yl]-2,2-dimethylpropanimidamide |
|---|---|
| PubChem CID | 155199968 |
| Molecular Formula | C33H55N3O |
| Molecular Weight | 509.82 g/mol |
| Exact Mass | 509.43 |
| IUPAC Name | 3-[(8S)-4-(cyclobutylmethyl)-8-hexan-2-yl-3-methyl-2-oxo-8-phenyl-azacycloundec-1-yl]-2,2-dimethylpropanimidamide |
| SMILES | [H]/N=C(\N)C(C)(C)CN1CCC[C@](c2ccccc2)(C(C)CCCC)CCCC(CC2CCC2)C(C)C1=O |
| InChI | InChI=1S/C33H55N3O/c1-6-7-14-25(2)33(29-18-9-8-10-19-29)20-12-17-28(23-27-15-11-16-27)26(3)30(37)36(22-13-21-33)24-32(4,5)31(34)35/h8-10,18-19,25-28H,6-7,11-17,20-24H2,1-5H3,(H3,34,35)/t25?,26?,28?,33-/m0/s1 |
| InChIKey | DIERODUIRQTDFI-KIAQWKHCSA-N |
| XLogP | 7.95 |
| TPSA | 70.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.82 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|