C17H14F8O5S — CID 155200352
2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate (PubChem CID 155200352) has the molecular formula C17H14F8O5S and a molecular weight of 482.35 g/mol. Its IUPAC name is 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate.
| Compound Name | 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 155200352 |
| Molecular Formula | C17H14F8O5S |
| Molecular Weight | 482.35 g/mol |
| Exact Mass | 482.04 |
| IUPAC Name | 2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl 6-(pentafluoro-λ6-sulfanyl)-2-(trifluoromethyl)-2H-chromene-3-carboxylate |
| SMILES | O=C(OC1COC2CCOC21)C1=Cc2cc(S(F)(F)(F)(F)F)ccc2OC1C(F)(F)F |
| InChI | InChI=1S/C17H14F8O5S/c18-17(19,20)15-10(16(26)30-13-7-28-12-3-4-27-14(12)13)6-8-5-9(1-2-11(8)29-15)31(21,22,23,24)25/h1-2,5-6,12-15H,3-4,7H2 |
| InChIKey | WRLIEOREWGJAMO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.35 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |