About 9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione
9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione (PubChem CID 155200936) has the molecular formula C21H12N2O4S
and a molecular weight of 388.40 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione.
Molecular Properties
| Compound Name | 9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione |
| PubChem CID | 155200936 |
| Molecular Formula | C21H12N2O4S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.05 |
| IUPAC Name | 9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione |
| SMILES | O=C1c2ccncc2C(=O)c2c1[nH]c1ccc(S(=O)(=O)c3ccccc3)cc21 |
| InChI | InChI=1S/C21H12N2O4S/c24-20-16-11-22-9-8-14(16)21(25)19-18(20)15-10-13(6-7-17(15)23-19)28(26,27)12-4-2-1-3-5-12/h1-11,23H |
| InChIKey | YPQUPPACOQXJHZ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 96.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione?
The IUPAC name of 9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione (CID 155200936) is 9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione.
What is the SMILES notation for 9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione?
The canonical SMILES for 9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione is O=C1c2ccncc2C(=O)c2c1[nH]c1ccc(S(=O)(=O)c3ccccc3)cc21.
What is the InChIKey of 9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione?
The InChIKey is YPQUPPACOQXJHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12N2O4S/c24-20-16-11-22-9-8-14(16)21(25)19-18(20)15-10-13(6-7-17(15)23-19)28(26,27)12-4-2-1-3-5-12/h1-11,23H.
What are the key properties of 9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione?
9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione has a molecular weight of 388.40 g/mol, XLogP of 3.17, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(benzenesulfonyl)-6H-pyrido[4,3-b]carbazole-5,11-dione is sourced from PubChem (CID 155200936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).