C11H21F2NO — CID 155201050
2-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]propan-2-ol (PubChem CID 155201050) has the molecular formula C11H21F2NO and a molecular weight of 221.29 g/mol. Its IUPAC name is 2-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]propan-2-ol.
| Compound Name | 2-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]propan-2-ol |
|---|---|
| PubChem CID | 155201050 |
| Molecular Formula | C11H21F2NO |
| Molecular Weight | 221.29 g/mol |
| Exact Mass | 221.16 |
| IUPAC Name | 2-[(2R)-1-tert-butyl-4,4-difluoropyrrolidin-2-yl]propan-2-ol |
| SMILES | CC(C)(O)[C@H]1CC(F)(F)CN1C(C)(C)C |
| InChI | InChI=1S/C11H21F2NO/c1-9(2,3)14-7-11(12,13)6-8(14)10(4,5)15/h8,15H,6-7H2,1-5H3/t8-/m1/s1 |
| InChIKey | FFCCKTIVEYLPAV-MRVPVSSYSA-N |
| XLogP | 2.27 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |