About 4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine
4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine (PubChem CID 155201713) has the molecular formula C10H20N2O
and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine.
Molecular Properties
| Compound Name | 4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine |
| PubChem CID | 155201713 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine |
| SMILES | C/C=C/C1C(NC)C(OC)CN1C |
| InChI | InChI=1S/C10H20N2O/c1-5-6-8-10(11-2)9(13-4)7-12(8)3/h5-6,8-11H,7H2,1-4H3/b6-5+ |
| InChIKey | JHKHPROTRSTIOW-AATRIKPKSA-N |
| XLogP | 0.48 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine?
The IUPAC name of 4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine (CID 155201713) is 4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine.
What is the SMILES notation for 4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine?
The canonical SMILES for 4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine is C/C=C/C1C(NC)C(OC)CN1C.
What is the InChIKey of 4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine?
The InChIKey is JHKHPROTRSTIOW-AATRIKPKSA-N. The full InChI is InChI=1S/C10H20N2O/c1-5-6-8-10(11-2)9(13-4)7-12(8)3/h5-6,8-11H,7H2,1-4H3/b6-5+.
What are the key properties of 4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine?
4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine has a molecular weight of 184.28 g/mol, XLogP of 0.48, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N,1-dimethyl-2-[(E)-prop-1-enyl]pyrrolidin-3-amine is sourced from PubChem (CID 155201713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).