About 5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide
5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide (PubChem CID 155201882) has the molecular formula C16H29N7O2
and a molecular weight of 351.46 g/mol. Its IUPAC name is 5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide.
Molecular Properties
| Compound Name | 5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide |
| PubChem CID | 155201882 |
| Molecular Formula | C16H29N7O2 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide |
| SMILES | CCCCCCNC(=O)c1ncc(C(=O)NCCCCN=C(N)N)[nH]1 |
| InChI | InChI=1S/C16H29N7O2/c1-2-3-4-5-8-20-15(25)13-22-11-12(23-13)14(24)19-9-6-7-10-21-16(17)18/h11H,2-10H2,1H3,(H,19,24)(H,20,25)(H,22,23)(H4,17,18,21) |
| InChIKey | HZVBNUXMIJSCJN-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 151.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide?
The IUPAC name of 5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide (CID 155201882) is 5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide.
What is the SMILES notation for 5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide?
The canonical SMILES for 5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide is CCCCCCNC(=O)c1ncc(C(=O)NCCCCN=C(N)N)[nH]1.
What is the InChIKey of 5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide?
The InChIKey is HZVBNUXMIJSCJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29N7O2/c1-2-3-4-5-8-20-15(25)13-22-11-12(23-13)14(24)19-9-6-7-10-21-16(17)18/h11H,2-10H2,1H3,(H,19,24)(H,20,25)(H,22,23)(H4,17,18,21).
What are the key properties of 5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide?
5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide has a molecular weight of 351.46 g/mol, XLogP of 0.50, 12 rotatable bonds, 5 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-[4-(diaminomethylideneamino)butyl]-2-N-hexyl-1H-imidazole-2,5-dicarboxamide is sourced from PubChem (CID 155201882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).