About 1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane
1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane (PubChem CID 155202039) has the molecular formula C13H17F3N4
and a molecular weight of 286.30 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | 1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane |
| PubChem CID | 155202039 |
| Molecular Formula | C13H17F3N4 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane |
| SMILES | FC(F)(F)c1ncc(N2CNCC23CCCCC3)cn1 |
| InChI | InChI=1S/C13H17F3N4/c14-13(15,16)11-18-6-10(7-19-11)20-9-17-8-12(20)4-2-1-3-5-12/h6-7,17H,1-5,8-9H2 |
| InChIKey | HQWLZKSDKSQJQG-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane?
The IUPAC name of 1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane (CID 155202039) is 1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane.
What is the SMILES notation for 1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane?
The canonical SMILES for 1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane is FC(F)(F)c1ncc(N2CNCC23CCCCC3)cn1.
What is the InChIKey of 1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane?
The InChIKey is HQWLZKSDKSQJQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3N4/c14-13(15,16)11-18-6-10(7-19-11)20-9-17-8-12(20)4-2-1-3-5-12/h6-7,17H,1-5,8-9H2.
What are the key properties of 1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane?
1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane has a molecular weight of 286.30 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(trifluoromethyl)pyrimidin-5-yl]-1,3-diazaspiro[4.5]decane is sourced from PubChem (CID 155202039), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).