C42H54P2 — CID 155202363
[(1R,2R)-2-[bis(3,4,5-trimethylphenyl)phosphanylmethyl]cyclobutyl]methyl-bis(3,4,5-trimethylphenyl)phosphane (PubChem CID 155202363) has the molecular formula C42H54P2 and a molecular weight of 620.84 g/mol. Its IUPAC name is [(1R,2R)-2-[bis(3,4,5-trimethylphenyl)phosphanylmethyl]cyclobutyl]methyl-bis(3,4,5-trimethylphenyl)phosphane.
| Compound Name | [(1R,2R)-2-[bis(3,4,5-trimethylphenyl)phosphanylmethyl]cyclobutyl]methyl-bis(3,4,5-trimethylphenyl)phosphane |
|---|---|
| PubChem CID | 155202363 |
| Molecular Formula | C42H54P2 |
| Molecular Weight | 620.84 g/mol |
| Exact Mass | 620.37 |
| IUPAC Name | [(1R,2R)-2-[bis(3,4,5-trimethylphenyl)phosphanylmethyl]cyclobutyl]methyl-bis(3,4,5-trimethylphenyl)phosphane |
| SMILES | Cc1cc(P(C[C@@H]2CC[C@H]2CP(c2cc(C)c(C)c(C)c2)c2cc(C)c(C)c(C)c2)c2cc(C)c(C)c(C)c2)cc(C)c1C |
| InChI | InChI=1S/C42H54P2/c1-25-15-39(16-26(2)33(25)9)43(40-17-27(3)34(10)28(4)18-40)23-37-13-14-38(37)24-44(41-19-29(5)35(11)30(6)20-41)42-21-31(7)36(12)32(8)22-42/h15-22,37-38H,13-14,23-24H2,1-12H3/t37-,38-/m0/s1 |
| InChIKey | HFNPPWPLMUQKKH-UWXQCODUSA-N |
| XLogP | 9.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.84 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|