C26H42O8 — CID 155203565
[2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-4-yl]methyl (E)-2,2-diethyl-5-(2-methylprop-2-enoyloxy)pent-4-enoate (PubChem CID 155203565) has the molecular formula C26H42O8 and a molecular weight of 482.61 g/mol. Its IUPAC name is [2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-4-yl]methyl (E)-2,2-diethyl-5-(2-methylprop-2-enoyloxy)pent-4-enoate.
| Compound Name | [2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-4-yl]methyl (E)-2,2-diethyl-5-(2-methylprop-2-enoyloxy)pent-4-enoate |
|---|---|
| PubChem CID | 155203565 |
| Molecular Formula | C26H42O8 |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | [2,2-dimethyl-6-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]-1,3-dioxan-4-yl]methyl (E)-2,2-diethyl-5-(2-methylprop-2-enoyloxy)pent-4-enoate |
| SMILES | C=C(C)C(=O)O/C=C/CC(CC)(CC)C(=O)OCC1CC(CC(=O)OC(C)(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C26H42O8/c1-10-26(11-2,13-12-14-30-22(28)18(3)4)23(29)31-17-20-15-19(32-25(8,9)33-20)16-21(27)34-24(5,6)7/h12,14,19-20H,3,10-11,13,15-17H2,1-2,4-9H3/b14-12+ |
| InChIKey | NFQBTWGOJNZTQK-WYMLVPIESA-N |
| XLogP | 5.00 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|